C8H8N2O3S — CID 174481963
3-[(sulfinoamino)methyl]-1,2-benzoxazole (PubChem CID 174481963) has the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. Its IUPAC name is 3-[(sulfinoamino)methyl]-1,2-benzoxazole.
| Compound Name | 3-[(sulfinoamino)methyl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 174481963 |
| Molecular Formula | C8H8N2O3S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 3-[(sulfinoamino)methyl]-1,2-benzoxazole |
| SMILES | O=S(O)NCc1noc2ccccc12 |
| InChI | InChI=1S/C8H8N2O3S/c11-14(12)9-5-7-6-3-1-2-4-8(6)13-10-7/h1-4,9H,5H2,(H,11,12) |
| InChIKey | BUVSULNMIRRQIT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|