About 3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene
3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene (PubChem CID 174482501) has the molecular formula C21H24ClNO2S
and a molecular weight of 389.95 g/mol. Its IUPAC name is 3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene.
Molecular Properties
| Compound Name | 3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene |
| PubChem CID | 174482501 |
| Molecular Formula | C21H24ClNO2S |
| Molecular Weight | 389.95 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene |
| SMILES | C=CCS(=O)(=O)n1cc(CCl)c2ccccc21.CC(C)c1ccccc1 |
| InChI | InChI=1S/C12H12ClNO2S.C9H12/c1-2-7-17(15,16)14-9-10(8-13)11-5-3-4-6-12(11)14;1-8(2)9-6-4-3-5-7-9/h2-6,9H,1,7-8H2;3-8H,1-2H3 |
| InChIKey | NCTHQJXAKVXFGQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.95 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene?
The IUPAC name of 3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene (CID 174482501) is 3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene.
What is the SMILES notation for 3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene?
The canonical SMILES for 3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene is C=CCS(=O)(=O)n1cc(CCl)c2ccccc21.CC(C)c1ccccc1.
What is the InChIKey of 3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene?
The InChIKey is NCTHQJXAKVXFGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNO2S.C9H12/c1-2-7-17(15,16)14-9-10(8-13)11-5-3-4-6-12(11)14;1-8(2)9-6-4-3-5-7-9/h2-6,9H,1,7-8H2;3-8H,1-2H3.
What are the key properties of 3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene?
3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene has a molecular weight of 389.95 g/mol, XLogP of 5.55, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-1-prop-2-enylsulfonylindole;cumene is sourced from PubChem (CID 174482501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).