C18H25NO4 — CID 174487728
3-O-benzyl 1-O-methyl (2R)-2-[[(1R,3R)-3-amino-3-methylcyclopentyl]methyl]propanedioate (PubChem CID 174487728) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 3-O-benzyl 1-O-methyl (2R)-2-[[(1R,3R)-3-amino-3-methylcyclopentyl]methyl]propanedioate.
| Compound Name | 3-O-benzyl 1-O-methyl (2R)-2-[[(1R,3R)-3-amino-3-methylcyclopentyl]methyl]propanedioate |
|---|---|
| PubChem CID | 174487728 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 3-O-benzyl 1-O-methyl (2R)-2-[[(1R,3R)-3-amino-3-methylcyclopentyl]methyl]propanedioate |
| SMILES | COC(=O)[C@@H](C[C@H]1CC[C@@](C)(N)C1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H25NO4/c1-18(19)9-8-14(11-18)10-15(16(20)22-2)17(21)23-12-13-6-4-3-5-7-13/h3-7,14-15H,8-12,19H2,1-2H3/t14-,15-,18-/m1/s1 |
| InChIKey | FDWPADNOTPZFIO-IIDMSEBBSA-N |
| XLogP | 2.43 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|