C32H41N3O6 — CID 174489340
tert-butyl formate;tert-butyl N-[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-2-yl]-N-[2-(1H-indol-3-yl)ethyl]carbamate (PubChem CID 174489340) has the molecular formula C32H41N3O6 and a molecular weight of 563.70 g/mol. Its IUPAC name is tert-butyl formate;tert-butyl N-[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-2-yl]-N-[2-(1H-indol-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl formate;tert-butyl N-[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-2-yl]-N-[2-(1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 174489340 |
| Molecular Formula | C32H41N3O6 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | tert-butyl formate;tert-butyl N-[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-2-yl]-N-[2-(1H-indol-3-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1c[nH]c2ccccc12)C1Cc2ccc(/C=C/C(=O)NO)cc2C1.CC(C)(C)OC=O |
| InChI | InChI=1S/C27H31N3O4.C5H10O2/c1-27(2,3)34-26(32)30(13-12-20-17-28-24-7-5-4-6-23(20)24)22-15-19-10-8-18(14-21(19)16-22)9-11-25(31)29-33;1-5(2,3)7-4-6/h4-11,14,17,22,28,33H,12-13,15-16H2,1-3H3,(H,29,31);4H,1-3H3/b11-9+; |
| InChIKey | DQYQPQWBLKMZOV-LBEJWNQZSA-N |
| XLogP | 5.59 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|