C31H33N5O3S — CID 174490055
4-[[2-[2-[1-[1-benzyl-5-(4-tert-butylphenyl)-4-hydroxypyrazol-3-yl]ethylidene]hydrazinyl]ethanethioyl]amino]benzoic acid (PubChem CID 174490055) has the molecular formula C31H33N5O3S and a molecular weight of 555.70 g/mol. Its IUPAC name is 4-[[2-[2-[1-[1-benzyl-5-(4-tert-butylphenyl)-4-hydroxypyrazol-3-yl]ethylidene]hydrazinyl]ethanethioyl]amino]benzoic acid.
| Compound Name | 4-[[2-[2-[1-[1-benzyl-5-(4-tert-butylphenyl)-4-hydroxypyrazol-3-yl]ethylidene]hydrazinyl]ethanethioyl]amino]benzoic acid |
|---|---|
| PubChem CID | 174490055 |
| Molecular Formula | C31H33N5O3S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 4-[[2-[2-[1-[1-benzyl-5-(4-tert-butylphenyl)-4-hydroxypyrazol-3-yl]ethylidene]hydrazinyl]ethanethioyl]amino]benzoic acid |
| SMILES | CC(=NNCC(=S)Nc1ccc(C(=O)O)cc1)c1nn(Cc2ccccc2)c(-c2ccc(C(C)(C)C)cc2)c1O |
| InChI | InChI=1S/C31H33N5O3S/c1-20(34-32-18-26(40)33-25-16-12-23(13-17-25)30(38)39)27-29(37)28(22-10-14-24(15-11-22)31(2,3)4)36(35-27)19-21-8-6-5-7-9-21/h5-17,32,37H,18-19H2,1-4H3,(H,33,40)(H,38,39) |
| InChIKey | AUGLGMKBVUIQNL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|