H4NO7P3+2 — CID 174491509
[amino-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-hydroxy-oxophosphanium (PubChem CID 174491509) has the molecular formula H4NO7P3+2 and a molecular weight of 222.95 g/mol. Its IUPAC name is [amino-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-hydroxy-oxophosphanium.
| Compound Name | [amino-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 174491509 |
| Molecular Formula | H4NO7P3+2 |
| Molecular Weight | 222.95 g/mol |
| Exact Mass | 222.92 |
| IUPAC Name | [amino-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-hydroxy-oxophosphanium |
| SMILES | NP(=O)(O[P+](=O)O)O[P+](=O)O |
| InChI | InChI=1S/H2NO7P3/c1-11(6,7-9(2)3)8-10(4)5/h(H2-2,1,2,3,4,5,6)/p+2 |
| InChIKey | ZRUWQDCWYMNYFS-UHFFFAOYSA-P |
| XLogP | 0.39 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.95 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|