About 4,5-dimethyloctoxysilane
4,5-dimethyloctoxysilane (PubChem CID 174499680) has the molecular formula C10H24OSi
and a molecular weight of 188.39 g/mol. Its IUPAC name is 4,5-dimethyloctoxysilane.
Molecular Properties
| Compound Name | 4,5-dimethyloctoxysilane |
| PubChem CID | 174499680 |
| Molecular Formula | C10H24OSi |
| Molecular Weight | 188.39 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 4,5-dimethyloctoxysilane |
| SMILES | CCCC(C)C(C)CCCO[SiH3] |
| InChI | InChI=1S/C10H24OSi/c1-4-6-9(2)10(3)7-5-8-11-12/h9-10H,4-8H2,1-3,12H3 |
| InChIKey | ROTNPLKMHZDJNX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyloctoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyloctoxysilane?
The IUPAC name of 4,5-dimethyloctoxysilane (CID 174499680) is 4,5-dimethyloctoxysilane.
What is the SMILES notation for 4,5-dimethyloctoxysilane?
The canonical SMILES for 4,5-dimethyloctoxysilane is CCCC(C)C(C)CCCO[SiH3].
What is the InChIKey of 4,5-dimethyloctoxysilane?
The InChIKey is ROTNPLKMHZDJNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24OSi/c1-4-6-9(2)10(3)7-5-8-11-12/h9-10H,4-8H2,1-3,12H3.
What are the key properties of 4,5-dimethyloctoxysilane?
4,5-dimethyloctoxysilane has a molecular weight of 188.39 g/mol, XLogP of 2.14, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyloctoxysilane is sourced from PubChem (CID 174499680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).