About 1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate
1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate (PubChem CID 174499902) has the molecular formula C15H13ClO4
and a molecular weight of 292.72 g/mol. Its IUPAC name is 1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | 1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate |
| PubChem CID | 174499902 |
| Molecular Formula | C15H13ClO4 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate |
| SMILES | CC(OC(=O)c1ccc(O)cc1)Oc1ccccc1Cl |
| InChI | InChI=1S/C15H13ClO4/c1-10(19-14-5-3-2-4-13(14)16)20-15(18)11-6-8-12(17)9-7-11/h2-10,17H,1H3 |
| InChIKey | FFQOBOSSYZZACY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate?
The IUPAC name of 1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate (CID 174499902) is 1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate.
What is the SMILES notation for 1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate?
The canonical SMILES for 1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate is CC(OC(=O)c1ccc(O)cc1)Oc1ccccc1Cl.
What is the InChIKey of 1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate?
The InChIKey is FFQOBOSSYZZACY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClO4/c1-10(19-14-5-3-2-4-13(14)16)20-15(18)11-6-8-12(17)9-7-11/h2-10,17H,1H3.
What are the key properties of 1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate?
1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate has a molecular weight of 292.72 g/mol, XLogP of 3.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenoxy)ethyl 4-hydroxybenzoate is sourced from PubChem (CID 174499902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).