C9H17NO3 — CID 174505401
tert-butyl (2S)-2-(aminomethyl)-2-methyl-3-oxopropanoate (PubChem CID 174505401) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is tert-butyl (2S)-2-(aminomethyl)-2-methyl-3-oxopropanoate.
| Compound Name | tert-butyl (2S)-2-(aminomethyl)-2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 174505401 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | tert-butyl (2S)-2-(aminomethyl)-2-methyl-3-oxopropanoate |
| SMILES | CC(C)(C)OC(=O)[C@](C)(C=O)CN |
| InChI | InChI=1S/C9H17NO3/c1-8(2,3)13-7(12)9(4,5-10)6-11/h6H,5,10H2,1-4H3/t9-/m0/s1 |
| InChIKey | UDMKOCSCMVEFDJ-VIFPVBQESA-N |
| XLogP | 0.49 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|