C13H25NO3 — CID 174373487
tert-butyl 2-amino-2-formyl-4,4-dimethylhexanoate (PubChem CID 174373487) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is tert-butyl 2-amino-2-formyl-4,4-dimethylhexanoate.
| Compound Name | tert-butyl 2-amino-2-formyl-4,4-dimethylhexanoate |
|---|---|
| PubChem CID | 174373487 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | tert-butyl 2-amino-2-formyl-4,4-dimethylhexanoate |
| SMILES | CCC(C)(C)CC(N)(C=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO3/c1-7-12(5,6)8-13(14,9-15)10(16)17-11(2,3)4/h9H,7-8,14H2,1-6H3 |
| InChIKey | UFLLUCYTJSJRPE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|