C20H23N3O3S — CID 174509870
tert-butyl 3-amino-3-(2-formyl-3-thiophen-2-yl-2H-quinoxalin-1-yl)propanoate (PubChem CID 174509870) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is tert-butyl 3-amino-3-(2-formyl-3-thiophen-2-yl-2H-quinoxalin-1-yl)propanoate.
| Compound Name | tert-butyl 3-amino-3-(2-formyl-3-thiophen-2-yl-2H-quinoxalin-1-yl)propanoate |
|---|---|
| PubChem CID | 174509870 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | tert-butyl 3-amino-3-(2-formyl-3-thiophen-2-yl-2H-quinoxalin-1-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)CC(N)N1c2ccccc2N=C(c2cccs2)C1C=O |
| InChI | InChI=1S/C20H23N3O3S/c1-20(2,3)26-18(25)11-17(21)23-14-8-5-4-7-13(14)22-19(15(23)12-24)16-9-6-10-27-16/h4-10,12,15,17H,11,21H2,1-3H3 |
| InChIKey | FULMKROZQVJWBJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|