C18H19NO2 — CID 174510033
2-(2-methoxyphenyl)-6-methyl-5,6,7,8-tetrahydroquinoline-5-carbaldehyde (PubChem CID 174510033) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-6-methyl-5,6,7,8-tetrahydroquinoline-5-carbaldehyde.
| Compound Name | 2-(2-methoxyphenyl)-6-methyl-5,6,7,8-tetrahydroquinoline-5-carbaldehyde |
|---|---|
| PubChem CID | 174510033 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-(2-methoxyphenyl)-6-methyl-5,6,7,8-tetrahydroquinoline-5-carbaldehyde |
| SMILES | COc1ccccc1-c1ccc2c(n1)CCC(C)C2C=O |
| InChI | InChI=1S/C18H19NO2/c1-12-7-9-16-13(15(12)11-20)8-10-17(19-16)14-5-3-4-6-18(14)21-2/h3-6,8,10-12,15H,7,9H2,1-2H3 |
| InChIKey | POWLYAAHBKEGKS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|