C4H7N5OS — CID 174515727
1,3-diamino-1-(1,3-thiazol-4-yl)urea (PubChem CID 174515727) has the molecular formula C4H7N5OS and a molecular weight of 173.20 g/mol. Its IUPAC name is 1,3-diamino-1-(1,3-thiazol-4-yl)urea.
| Compound Name | 1,3-diamino-1-(1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 174515727 |
| Molecular Formula | C4H7N5OS |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | 1,3-diamino-1-(1,3-thiazol-4-yl)urea |
| SMILES | NNC(=O)N(N)c1cscn1 |
| InChI | InChI=1S/C4H7N5OS/c5-8-4(10)9(6)3-1-11-2-7-3/h1-2H,5-6H2,(H,8,10) |
| InChIKey | CNUFPGSSISYWDQ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|