C13H16F3N3O2 — CID 174519349
5-(dimethylaminomethylideneamino)-4-ethyl-6-methyl-2-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 174519349) has the molecular formula C13H16F3N3O2 and a molecular weight of 303.28 g/mol. Its IUPAC name is 5-(dimethylaminomethylideneamino)-4-ethyl-6-methyl-2-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 5-(dimethylaminomethylideneamino)-4-ethyl-6-methyl-2-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 174519349 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 5-(dimethylaminomethylideneamino)-4-ethyl-6-methyl-2-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | CCc1c(/N=C/N(C)C)c(C)nc(C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C13H16F3N3O2/c1-5-8-9(12(20)21)11(13(14,15)16)18-7(2)10(8)17-6-19(3)4/h6H,5H2,1-4H3,(H,20,21)/b17-6+ |
| InChIKey | YSVARHCWZFYWGG-UBKPWBPPSA-N |
| XLogP | 2.89 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|