C17H12N2OS2 — CID 174520036
2-(6-thiophen-2-yl-4H-thieno[3,2-b]pyrrol-5-yl)benzamide (PubChem CID 174520036) has the molecular formula C17H12N2OS2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-(6-thiophen-2-yl-4H-thieno[3,2-b]pyrrol-5-yl)benzamide.
| Compound Name | 2-(6-thiophen-2-yl-4H-thieno[3,2-b]pyrrol-5-yl)benzamide |
|---|---|
| PubChem CID | 174520036 |
| Molecular Formula | C17H12N2OS2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 2-(6-thiophen-2-yl-4H-thieno[3,2-b]pyrrol-5-yl)benzamide |
| SMILES | NC(=O)c1ccccc1-c1[nH]c2ccsc2c1-c1cccs1 |
| InChI | InChI=1S/C17H12N2OS2/c18-17(20)11-5-2-1-4-10(11)15-14(13-6-3-8-21-13)16-12(19-15)7-9-22-16/h1-9,19H,(H2,18,20) |
| InChIKey | IELNCODGNLLYTF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |