C19H12Cl2N2OS2 — CID 175249422
2-[6-(3,5-dichlorophenyl)sulfanyl-4H-thieno[3,2-b]pyrrol-5-yl]benzamide (PubChem CID 175249422) has the molecular formula C19H12Cl2N2OS2 and a molecular weight of 419.36 g/mol. Its IUPAC name is 2-[6-(3,5-dichlorophenyl)sulfanyl-4H-thieno[3,2-b]pyrrol-5-yl]benzamide.
| Compound Name | 2-[6-(3,5-dichlorophenyl)sulfanyl-4H-thieno[3,2-b]pyrrol-5-yl]benzamide |
|---|---|
| PubChem CID | 175249422 |
| Molecular Formula | C19H12Cl2N2OS2 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 2-[6-(3,5-dichlorophenyl)sulfanyl-4H-thieno[3,2-b]pyrrol-5-yl]benzamide |
| SMILES | NC(=O)c1ccccc1-c1[nH]c2ccsc2c1Sc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H12Cl2N2OS2/c20-10-7-11(21)9-12(8-10)26-18-16(23-15-5-6-25-17(15)18)13-3-1-2-4-14(13)19(22)24/h1-9,23H,(H2,22,24) |
| InChIKey | GBAIVASMXKLDPF-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |