C21H18N2OS2 — CID 174533177
2-[6-(2-ethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrol-5-yl]benzamide (PubChem CID 174533177) has the molecular formula C21H18N2OS2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-[6-(2-ethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrol-5-yl]benzamide.
| Compound Name | 2-[6-(2-ethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrol-5-yl]benzamide |
|---|---|
| PubChem CID | 174533177 |
| Molecular Formula | C21H18N2OS2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-[6-(2-ethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrol-5-yl]benzamide |
| SMILES | CCc1ccccc1Sc1c(-c2ccccc2C(N)=O)[nH]c2ccsc12 |
| InChI | InChI=1S/C21H18N2OS2/c1-2-13-7-3-6-10-17(13)26-20-18(23-16-11-12-25-19(16)20)14-8-4-5-9-15(14)21(22)24/h3-12,23H,2H2,1H3,(H2,22,24) |
| InChIKey | LFZQMOVIRRFCIE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |