C25H29N3O2S — CID 174523503
N-[6-(4-imino-5-phenylpentan-2-yl)-3-pyridinyl]-4-propan-2-ylbenzenesulfonamide (PubChem CID 174523503) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is N-[6-(4-imino-5-phenylpentan-2-yl)-3-pyridinyl]-4-propan-2-ylbenzenesulfonamide.
| Compound Name | N-[6-(4-imino-5-phenylpentan-2-yl)-3-pyridinyl]-4-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 174523503 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-[6-(4-imino-5-phenylpentan-2-yl)-3-pyridinyl]-4-propan-2-ylbenzenesulfonamide |
| SMILES | [H]/N=C(/Cc1ccccc1)CC(C)c1ccc(NS(=O)(=O)c2ccc(C(C)C)cc2)cn1 |
| InChI | InChI=1S/C25H29N3O2S/c1-18(2)21-9-12-24(13-10-21)31(29,30)28-23-11-14-25(27-17-23)19(3)15-22(26)16-20-7-5-4-6-8-20/h4-14,17-19,26,28H,15-16H2,1-3H3/b26-22+ |
| InChIKey | ZBZMBJQVERJBCU-XTCLZLMSSA-N |
| XLogP | 5.76 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|