C8H20N2O3Si — CID 174529997
(2-amino-3-hydroxy-3-trimethylsilylpropyl)-methylcarbamic acid (PubChem CID 174529997) has the molecular formula C8H20N2O3Si and a molecular weight of 220.34 g/mol. Its IUPAC name is (2-amino-3-hydroxy-3-trimethylsilylpropyl)-methylcarbamic acid.
| Compound Name | (2-amino-3-hydroxy-3-trimethylsilylpropyl)-methylcarbamic acid |
|---|---|
| PubChem CID | 174529997 |
| Molecular Formula | C8H20N2O3Si |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (2-amino-3-hydroxy-3-trimethylsilylpropyl)-methylcarbamic acid |
| SMILES | CN(CC(N)C(O)[Si](C)(C)C)C(=O)O |
| InChI | InChI=1S/C8H20N2O3Si/c1-10(8(12)13)5-6(9)7(11)14(2,3)4/h6-7,11H,5,9H2,1-4H3,(H,12,13) |
| InChIKey | YUHNPLPRDVGHJL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|