C22H27FN2O3S — CID 174530455
6-[7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-4-imino-N-methylhexan-2-amine (PubChem CID 174530455) has the molecular formula C22H27FN2O3S and a molecular weight of 418.53 g/mol. Its IUPAC name is 6-[7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-4-imino-N-methylhexan-2-amine.
| Compound Name | 6-[7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-4-imino-N-methylhexan-2-amine |
|---|---|
| PubChem CID | 174530455 |
| Molecular Formula | C22H27FN2O3S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 6-[7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-4-imino-N-methylhexan-2-amine |
| SMILES | [H]/N=C(/CCC1CCOc2cc(S(=O)(=O)c3cccc(F)c3)ccc21)CC(C)NC |
| InChI | InChI=1S/C22H27FN2O3S/c1-15(25-2)12-18(24)7-6-16-10-11-28-22-14-20(8-9-21(16)22)29(26,27)19-5-3-4-17(23)13-19/h3-5,8-9,13-16,24-25H,6-7,10-12H2,1-2H3/b24-18- |
| InChIKey | YTHIVNZAGQVCMZ-MOHJPFBDSA-N |
| XLogP | 4.32 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|