C17H14ClFO4S — CID 58668691
2-[7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-yl]acetyl chloride (PubChem CID 58668691) has the molecular formula C17H14ClFO4S and a molecular weight of 368.81 g/mol. Its IUPAC name is 2-[7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-yl]acetyl chloride.
| Compound Name | 2-[7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-yl]acetyl chloride |
|---|---|
| PubChem CID | 58668691 |
| Molecular Formula | C17H14ClFO4S |
| Molecular Weight | 368.81 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 2-[7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-yl]acetyl chloride |
| SMILES | O=C(Cl)CC1CCOc2cc(S(=O)(=O)c3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C17H14ClFO4S/c18-17(20)8-11-6-7-23-16-10-14(4-5-15(11)16)24(21,22)13-3-1-2-12(19)9-13/h1-5,9-11H,6-8H2 |
| InChIKey | CFJNMORPOWAIJK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|