C14H18N2O4 — CID 174531370
(4-nitro-2,3-dihydro-1H-indol-3-yl) 2-ethylbutanoate (PubChem CID 174531370) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (4-nitro-2,3-dihydro-1H-indol-3-yl) 2-ethylbutanoate.
| Compound Name | (4-nitro-2,3-dihydro-1H-indol-3-yl) 2-ethylbutanoate |
|---|---|
| PubChem CID | 174531370 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (4-nitro-2,3-dihydro-1H-indol-3-yl) 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)OC1CNc2cccc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C14H18N2O4/c1-3-9(4-2)14(17)20-12-8-15-10-6-5-7-11(13(10)12)16(18)19/h5-7,9,12,15H,3-4,8H2,1-2H3 |
| InChIKey | WSEVSYPAOSVLAZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|