C16H21N3O2S2 — CID 174531548
1-(4-methyl-2-pentylsulfinylphenyl)-3-(1,3-thiazol-2-yl)urea (PubChem CID 174531548) has the molecular formula C16H21N3O2S2 and a molecular weight of 351.50 g/mol. Its IUPAC name is 1-(4-methyl-2-pentylsulfinylphenyl)-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-(4-methyl-2-pentylsulfinylphenyl)-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 174531548 |
| Molecular Formula | C16H21N3O2S2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 1-(4-methyl-2-pentylsulfinylphenyl)-3-(1,3-thiazol-2-yl)urea |
| SMILES | CCCCCS(=O)c1cc(C)ccc1NC(=O)Nc1nccs1 |
| InChI | InChI=1S/C16H21N3O2S2/c1-3-4-5-10-23(21)14-11-12(2)6-7-13(14)18-15(20)19-16-17-8-9-22-16/h6-9,11H,3-5,10H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | VXQMJAHXXVCUQL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|