C16H19N3O2S — CID 59733134
1-[4-methyl-2-(3-methylbut-2-enoxy)phenyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 59733134) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-[4-methyl-2-(3-methylbut-2-enoxy)phenyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[4-methyl-2-(3-methylbut-2-enoxy)phenyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 59733134 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-[4-methyl-2-(3-methylbut-2-enoxy)phenyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | CC(C)=CCOc1cc(C)ccc1NC(=O)Nc1nccs1 |
| InChI | InChI=1S/C16H19N3O2S/c1-11(2)6-8-21-14-10-12(3)4-5-13(14)18-15(20)19-16-17-7-9-22-16/h4-7,9-10H,8H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | HOJDEZPIRNMFJD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|