C18H21NO2S — CID 58541142
1-[4-methyl-2-(3-methylbut-2-enoxy)phenyl]-3-(1,3-thiazol-2-yl)propan-2-one (PubChem CID 58541142) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-[4-methyl-2-(3-methylbut-2-enoxy)phenyl]-3-(1,3-thiazol-2-yl)propan-2-one.
| Compound Name | 1-[4-methyl-2-(3-methylbut-2-enoxy)phenyl]-3-(1,3-thiazol-2-yl)propan-2-one |
|---|---|
| PubChem CID | 58541142 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-[4-methyl-2-(3-methylbut-2-enoxy)phenyl]-3-(1,3-thiazol-2-yl)propan-2-one |
| SMILES | CC(C)=CCOc1cc(C)ccc1CC(=O)Cc1nccs1 |
| InChI | InChI=1S/C18H21NO2S/c1-13(2)6-8-21-17-10-14(3)4-5-15(17)11-16(20)12-18-19-7-9-22-18/h4-7,9-10H,8,11-12H2,1-3H3 |
| InChIKey | CSTZNZRPOCMVCW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|