C10H19NO6S — CID 174531773
2-(3-aminophenyl)ethanol;methoxymethane;sulfuric acid (PubChem CID 174531773) has the molecular formula C10H19NO6S and a molecular weight of 281.33 g/mol. Its IUPAC name is 2-(3-aminophenyl)ethanol;methoxymethane;sulfuric acid.
| Compound Name | 2-(3-aminophenyl)ethanol;methoxymethane;sulfuric acid |
|---|---|
| PubChem CID | 174531773 |
| Molecular Formula | C10H19NO6S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-(3-aminophenyl)ethanol;methoxymethane;sulfuric acid |
| SMILES | COC.Nc1cccc(CCO)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H11NO.C2H6O.H2O4S/c9-8-3-1-2-7(6-8)4-5-10;1-3-2;1-5(2,3)4/h1-3,6,10H,4-5,9H2;1-2H3;(H2,1,2,3,4) |
| InChIKey | MZILQCOFEFFURM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|