C8H12NO3S2+ — CID 172763547
2-(3-aminophenyl)ethyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium (PubChem CID 172763547) has the molecular formula C8H12NO3S2+ and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-(3-aminophenyl)ethyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium.
| Compound Name | 2-(3-aminophenyl)ethyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium |
|---|---|
| PubChem CID | 172763547 |
| Molecular Formula | C8H12NO3S2+ |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-(3-aminophenyl)ethyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium |
| SMILES | Nc1cccc(CC[S+]=S(=O)(O)O)c1 |
| InChI | InChI=1S/C8H11NO3S2/c9-8-3-1-2-7(6-8)4-5-13-14(10,11)12/h1-3,6H,4-5,9H2,(H-,10,11,12)/p+1 |
| InChIKey | LZXWKUATJRITGP-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|