C8H13N2O3S2+ — CID 172721523
2-(3,5-diaminophenyl)ethyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium (PubChem CID 172721523) has the molecular formula C8H13N2O3S2+ and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-(3,5-diaminophenyl)ethyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium.
| Compound Name | 2-(3,5-diaminophenyl)ethyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium |
|---|---|
| PubChem CID | 172721523 |
| Molecular Formula | C8H13N2O3S2+ |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 2-(3,5-diaminophenyl)ethyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium |
| SMILES | Nc1cc(N)cc(CC[S+]=S(=O)(O)O)c1 |
| InChI | InChI=1S/C8H12N2O3S2/c9-7-3-6(4-8(10)5-7)1-2-14-15(11,12)13/h3-5H,1-2,9-10H2,(H-,11,12,13)/p+1 |
| InChIKey | GOQJCOUJDIXIRL-UHFFFAOYSA-O |
| XLogP | 0.62 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|