C9H14NO3S2+ — CID 172682666
3-(3-aminophenyl)propyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium (PubChem CID 172682666) has the molecular formula C9H14NO3S2+ and a molecular weight of 248.35 g/mol. Its IUPAC name is 3-(3-aminophenyl)propyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium.
| Compound Name | 3-(3-aminophenyl)propyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium |
|---|---|
| PubChem CID | 172682666 |
| Molecular Formula | C9H14NO3S2+ |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 3-(3-aminophenyl)propyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium |
| SMILES | Nc1cccc(CCC[S+]=S(=O)(O)O)c1 |
| InChI | InChI=1S/C9H13NO3S2/c10-9-5-1-3-8(7-9)4-2-6-14-15(11,12)13/h1,3,5,7H,2,4,6,10H2,(H-,11,12,13)/p+1 |
| InChIKey | APRFMUXUOZHHOI-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|