C7H11N2O3S2+ — CID 172685546
(3,5-diaminophenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium (PubChem CID 172685546) has the molecular formula C7H11N2O3S2+ and a molecular weight of 235.31 g/mol. Its IUPAC name is (3,5-diaminophenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium.
| Compound Name | (3,5-diaminophenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium |
|---|---|
| PubChem CID | 172685546 |
| Molecular Formula | C7H11N2O3S2+ |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | (3,5-diaminophenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium |
| SMILES | Nc1cc(N)cc(C[S+]=S(=O)(O)O)c1 |
| InChI | InChI=1S/C7H10N2O3S2/c8-6-1-5(2-7(9)3-6)4-13-14(10,11)12/h1-3H,4,8-9H2,(H-,10,11,12)/p+1 |
| InChIKey | AZHZYHVXOHOKMK-UHFFFAOYSA-O |
| XLogP | 0.58 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|