C23H19ClFNO4 — CID 174532360
[1-[[4-chloro-1-[(4-fluorophenyl)methoxy]naphthalene-2-carbonyl]amino]cyclobutyl] formate (PubChem CID 174532360) has the molecular formula C23H19ClFNO4 and a molecular weight of 427.86 g/mol. Its IUPAC name is [1-[[4-chloro-1-[(4-fluorophenyl)methoxy]naphthalene-2-carbonyl]amino]cyclobutyl] formate.
| Compound Name | [1-[[4-chloro-1-[(4-fluorophenyl)methoxy]naphthalene-2-carbonyl]amino]cyclobutyl] formate |
|---|---|
| PubChem CID | 174532360 |
| Molecular Formula | C23H19ClFNO4 |
| Molecular Weight | 427.86 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | [1-[[4-chloro-1-[(4-fluorophenyl)methoxy]naphthalene-2-carbonyl]amino]cyclobutyl] formate |
| SMILES | O=COC1(NC(=O)c2cc(Cl)c3ccccc3c2OCc2ccc(F)cc2)CCC1 |
| InChI | InChI=1S/C23H19ClFNO4/c24-20-12-19(22(28)26-23(30-14-27)10-3-11-23)21(18-5-2-1-4-17(18)20)29-13-15-6-8-16(25)9-7-15/h1-2,4-9,12,14H,3,10-11,13H2,(H,26,28) |
| InChIKey | CWGLWHOJNVXONP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.86 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|