C10H21N3 — CID 174534223
2-ethyl-1-pentyl-4,5-dihydroimidazol-4-amine (PubChem CID 174534223) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 2-ethyl-1-pentyl-4,5-dihydroimidazol-4-amine.
| Compound Name | 2-ethyl-1-pentyl-4,5-dihydroimidazol-4-amine |
|---|---|
| PubChem CID | 174534223 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 2-ethyl-1-pentyl-4,5-dihydroimidazol-4-amine |
| SMILES | CCCCCN1CC(N)N=C1CC |
| InChI | InChI=1S/C10H21N3/c1-3-5-6-7-13-8-9(11)12-10(13)4-2/h9H,3-8,11H2,1-2H3 |
| InChIKey | NICANJVZSFSRJJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|