C23H19F3N4O — CID 174536266
1-(2-methyl-1-pyridin-4-ylindol-4-yl)-3-[4-methyl-3-(trifluoromethyl)phenyl]urea (PubChem CID 174536266) has the molecular formula C23H19F3N4O and a molecular weight of 424.43 g/mol. Its IUPAC name is 1-(2-methyl-1-pyridin-4-ylindol-4-yl)-3-[4-methyl-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2-methyl-1-pyridin-4-ylindol-4-yl)-3-[4-methyl-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 174536266 |
| Molecular Formula | C23H19F3N4O |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-(2-methyl-1-pyridin-4-ylindol-4-yl)-3-[4-methyl-3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2cccc3c2cc(C)n3-c2ccncc2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H19F3N4O/c1-14-6-7-16(13-19(14)23(24,25)26)28-22(31)29-20-4-3-5-21-18(20)12-15(2)30(21)17-8-10-27-11-9-17/h3-13H,1-2H3,(H2,28,29,31) |
| InChIKey | KBALBBZFIULXDS-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |