C22H18F3N5O2 — CID 15604339
1-[2-methoxy-5-(trifluoromethyl)phenyl]-3-(2-methyl-1-pyridin-4-ylbenzimidazol-4-yl)urea (PubChem CID 15604339) has the molecular formula C22H18F3N5O2 and a molecular weight of 441.41 g/mol. Its IUPAC name is 1-[2-methoxy-5-(trifluoromethyl)phenyl]-3-(2-methyl-1-pyridin-4-ylbenzimidazol-4-yl)urea.
| Compound Name | 1-[2-methoxy-5-(trifluoromethyl)phenyl]-3-(2-methyl-1-pyridin-4-ylbenzimidazol-4-yl)urea |
|---|---|
| PubChem CID | 15604339 |
| Molecular Formula | C22H18F3N5O2 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 1-[2-methoxy-5-(trifluoromethyl)phenyl]-3-(2-methyl-1-pyridin-4-ylbenzimidazol-4-yl)urea |
| SMILES | COc1ccc(C(F)(F)F)cc1NC(=O)Nc1cccc2c1nc(C)n2-c1ccncc1 |
| InChI | InChI=1S/C22H18F3N5O2/c1-13-27-20-16(4-3-5-18(20)30(13)15-8-10-26-11-9-15)28-21(31)29-17-12-14(22(23,24)25)6-7-19(17)32-2/h3-12H,1-2H3,(H2,28,29,31) |
| InChIKey | SHRXIHYMPOYKJD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |