C24H22Cl2N2O6S — CID 174544606
2-[3-[3-amino-2-(2,4-dichloro-5-methylphenyl)sulfonyl-4-(ethylcarbamoyl)phenoxy]phenyl]acetic acid (PubChem CID 174544606) has the molecular formula C24H22Cl2N2O6S and a molecular weight of 537.42 g/mol. Its IUPAC name is 2-[3-[3-amino-2-(2,4-dichloro-5-methylphenyl)sulfonyl-4-(ethylcarbamoyl)phenoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[3-amino-2-(2,4-dichloro-5-methylphenyl)sulfonyl-4-(ethylcarbamoyl)phenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 174544606 |
| Molecular Formula | C24H22Cl2N2O6S |
| Molecular Weight | 537.42 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | 2-[3-[3-amino-2-(2,4-dichloro-5-methylphenyl)sulfonyl-4-(ethylcarbamoyl)phenoxy]phenyl]acetic acid |
| SMILES | CCNC(=O)c1ccc(Oc2cccc(CC(=O)O)c2)c(S(=O)(=O)c2cc(C)c(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C24H22Cl2N2O6S/c1-3-28-24(31)16-7-8-19(34-15-6-4-5-14(10-15)11-21(29)30)23(22(16)27)35(32,33)20-9-13(2)17(25)12-18(20)26/h4-10,12H,3,11,27H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | HBAYJDPRXVJTDT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|