C20H17ClN2O5S — CID 45486034
2-[3-[4-amino-2-[(4-chlorophenyl)sulfonylamino]phenoxy]phenyl]acetic acid (PubChem CID 45486034) has the molecular formula C20H17ClN2O5S and a molecular weight of 432.89 g/mol. Its IUPAC name is 2-[3-[4-amino-2-[(4-chlorophenyl)sulfonylamino]phenoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[4-amino-2-[(4-chlorophenyl)sulfonylamino]phenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 45486034 |
| Molecular Formula | C20H17ClN2O5S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 2-[3-[4-amino-2-[(4-chlorophenyl)sulfonylamino]phenoxy]phenyl]acetic acid |
| SMILES | Nc1ccc(Oc2cccc(CC(=O)O)c2)c(NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H17ClN2O5S/c21-14-4-7-17(8-5-14)29(26,27)23-18-12-15(22)6-9-19(18)28-16-3-1-2-13(10-16)11-20(24)25/h1-10,12,23H,11,22H2,(H,24,25) |
| InChIKey | KJAGTNQZIYPSQP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|