C21H18ClN3O6S — CID 59644637
2-[3-[4-(carbamoylamino)-2-[(4-chlorophenyl)sulfonylamino]phenoxy]phenyl]acetic acid (PubChem CID 59644637) has the molecular formula C21H18ClN3O6S and a molecular weight of 475.91 g/mol. Its IUPAC name is 2-[3-[4-(carbamoylamino)-2-[(4-chlorophenyl)sulfonylamino]phenoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[4-(carbamoylamino)-2-[(4-chlorophenyl)sulfonylamino]phenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 59644637 |
| Molecular Formula | C21H18ClN3O6S |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 2-[3-[4-(carbamoylamino)-2-[(4-chlorophenyl)sulfonylamino]phenoxy]phenyl]acetic acid |
| SMILES | NC(=O)Nc1ccc(Oc2cccc(CC(=O)O)c2)c(NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H18ClN3O6S/c22-14-4-7-17(8-5-14)32(29,30)25-18-12-15(24-21(23)28)6-9-19(18)31-16-3-1-2-13(10-16)11-20(26)27/h1-10,12,25H,11H2,(H,26,27)(H3,23,24,28) |
| InChIKey | MPZYHKMDSLEXKK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |