About (5-phenylthiophen-2-yl) formate
(5-phenylthiophen-2-yl) formate (PubChem CID 174545839) has the molecular formula C11H8O2S
and a molecular weight of 204.25 g/mol. Its IUPAC name is (5-phenylthiophen-2-yl) formate.
Molecular Properties
| Compound Name | (5-phenylthiophen-2-yl) formate |
| PubChem CID | 174545839 |
| Molecular Formula | C11H8O2S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | (5-phenylthiophen-2-yl) formate |
| SMILES | O=COc1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C11H8O2S/c12-8-13-11-7-6-10(14-11)9-4-2-1-3-5-9/h1-8H |
| InChIKey | YAFVPRGXNUBMAW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5-phenylthiophen-2-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-phenylthiophen-2-yl) formate?
The IUPAC name of (5-phenylthiophen-2-yl) formate (CID 174545839) is (5-phenylthiophen-2-yl) formate.
What is the SMILES notation for (5-phenylthiophen-2-yl) formate?
The canonical SMILES for (5-phenylthiophen-2-yl) formate is O=COc1ccc(-c2ccccc2)s1.
What is the InChIKey of (5-phenylthiophen-2-yl) formate?
The InChIKey is YAFVPRGXNUBMAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O2S/c12-8-13-11-7-6-10(14-11)9-4-2-1-3-5-9/h1-8H.
What are the key properties of (5-phenylthiophen-2-yl) formate?
(5-phenylthiophen-2-yl) formate has a molecular weight of 204.25 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-phenylthiophen-2-yl) formate is sourced from PubChem (CID 174545839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).