About 1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde
1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde (PubChem CID 174547856) has the molecular formula C9H9N3O3
and a molecular weight of 207.19 g/mol. Its IUPAC name is 1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde |
| PubChem CID | 174547856 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde |
| SMILES | CN1NC(C=O)c2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N3O3/c1-11-7-3-2-4-8(12(14)15)9(7)6(5-13)10-11/h2-6,10H,1H3 |
| InChIKey | CJALCSJBUOTIHD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde?
The IUPAC name of 1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde (CID 174547856) is 1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde.
What is the SMILES notation for 1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde?
The canonical SMILES for 1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde is CN1NC(C=O)c2c1cccc2[N+](=O)[O-].
What is the InChIKey of 1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde?
The InChIKey is CJALCSJBUOTIHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3/c1-11-7-3-2-4-8(12(14)15)9(7)6(5-13)10-11/h2-6,10H,1H3.
What are the key properties of 1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde?
1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde has a molecular weight of 207.19 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-nitro-2,3-dihydroindazole-3-carbaldehyde is sourced from PubChem (CID 174547856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).