C22H22N8O2 — CID 174548533
1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-1-[(4-morpholin-4-ylpyrimidin-5-yl)methyl]urea (PubChem CID 174548533) has the molecular formula C22H22N8O2 and a molecular weight of 430.47 g/mol. Its IUPAC name is 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-1-[(4-morpholin-4-ylpyrimidin-5-yl)methyl]urea.
| Compound Name | 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-1-[(4-morpholin-4-ylpyrimidin-5-yl)methyl]urea |
|---|---|
| PubChem CID | 174548533 |
| Molecular Formula | C22H22N8O2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-1-[(4-morpholin-4-ylpyrimidin-5-yl)methyl]urea |
| SMILES | NC(=O)N(Cc1cncnc1N1CCOCC1)c1cccc(C#Cc2cnc(N)nc2)c1 |
| InChI | InChI=1S/C22H22N8O2/c23-21-26-11-17(12-27-21)5-4-16-2-1-3-19(10-16)30(22(24)31)14-18-13-25-15-28-20(18)29-6-8-32-9-7-29/h1-3,10-13,15H,6-9,14H2,(H2,24,31)(H2,23,26,27) |
| InChIKey | NOMCCWVDYWPXBL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|