C22H24ClNOS — CID 174553264
2-[[4-[phenyl(thiophen-2-yl)methyl]phenoxy]methyl]pyrrolidine;hydrochloride (PubChem CID 174553264) has the molecular formula C22H24ClNOS and a molecular weight of 385.96 g/mol. Its IUPAC name is 2-[[4-[phenyl(thiophen-2-yl)methyl]phenoxy]methyl]pyrrolidine;hydrochloride.
| Compound Name | 2-[[4-[phenyl(thiophen-2-yl)methyl]phenoxy]methyl]pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 174553264 |
| Molecular Formula | C22H24ClNOS |
| Molecular Weight | 385.96 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[[4-[phenyl(thiophen-2-yl)methyl]phenoxy]methyl]pyrrolidine;hydrochloride |
| SMILES | Cl.c1ccc(C(c2ccc(OCC3CCCN3)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C22H23NOS.ClH/c1-2-6-17(7-3-1)22(21-9-5-15-25-21)18-10-12-20(13-11-18)24-16-19-8-4-14-23-19;/h1-3,5-7,9-13,15,19,22-23H,4,8,14,16H2;1H |
| InChIKey | XLNQCSJDLBCHLS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.96 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |