About 2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate
2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate (PubChem CID 174559223) has the molecular formula C17H20O7
and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate.
Molecular Properties
| Compound Name | 2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate |
| PubChem CID | 174559223 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate |
| SMILES | C=CC(=O)OOC(=O)c1ccc(C(=O)OC(CC)C(C)O)cc1C |
| InChI | InChI=1S/C17H20O7/c1-5-14(11(4)18)22-16(20)12-7-8-13(10(3)9-12)17(21)24-23-15(19)6-2/h6-9,11,14,18H,2,5H2,1,3-4H3 |
| InChIKey | WKXDCMDSVJCGIG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate?
The IUPAC name of 2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate (CID 174559223) is 2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate.
What is the SMILES notation for 2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate?
The canonical SMILES for 2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate is C=CC(=O)OOC(=O)c1ccc(C(=O)OC(CC)C(C)O)cc1C.
What is the InChIKey of 2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate?
The InChIKey is WKXDCMDSVJCGIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O7/c1-5-14(11(4)18)22-16(20)12-7-8-13(10(3)9-12)17(21)24-23-15(19)6-2/h6-9,11,14,18H,2,5H2,1,3-4H3.
What are the key properties of 2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate?
2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate has a molecular weight of 336.34 g/mol, XLogP of 2.11, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypentan-3-yl 3-methyl-4-prop-2-enoylperoxycarbonylbenzoate is sourced from PubChem (CID 174559223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).