C9H9BrCl2O — CID 174560641
1-bromo-2,4-dichlorobenzene;propanal (PubChem CID 174560641) has the molecular formula C9H9BrCl2O and a molecular weight of 283.98 g/mol. Its IUPAC name is 1-bromo-2,4-dichlorobenzene;propanal.
| Compound Name | 1-bromo-2,4-dichlorobenzene;propanal |
|---|---|
| PubChem CID | 174560641 |
| Molecular Formula | C9H9BrCl2O |
| Molecular Weight | 283.98 g/mol |
| Exact Mass | 281.92 |
| IUPAC Name | 1-bromo-2,4-dichlorobenzene;propanal |
| SMILES | CCC=O.Clc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C6H3BrCl2.C3H6O/c7-5-2-1-4(8)3-6(5)9;1-2-3-4/h1-3H;3H,2H2,1H3 |
| InChIKey | DULTTXHUZLMDOW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.98 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|