C14H15N5O5S — CID 174564487
(2S,3R,4S,5R)-2-(2-amino-6-thiophen-2-ylpurin-9-yl)-5-(hydroxymethyl)oxolane-2,3,4-triol (PubChem CID 174564487) has the molecular formula C14H15N5O5S and a molecular weight of 365.37 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(2-amino-6-thiophen-2-ylpurin-9-yl)-5-(hydroxymethyl)oxolane-2,3,4-triol.
| Compound Name | (2S,3R,4S,5R)-2-(2-amino-6-thiophen-2-ylpurin-9-yl)-5-(hydroxymethyl)oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 174564487 |
| Molecular Formula | C14H15N5O5S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | (2S,3R,4S,5R)-2-(2-amino-6-thiophen-2-ylpurin-9-yl)-5-(hydroxymethyl)oxolane-2,3,4-triol |
| SMILES | Nc1nc(-c2cccs2)c2ncn([C@@]3(O)O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C14H15N5O5S/c15-13-17-8(7-2-1-3-25-7)9-12(18-13)19(5-16-9)14(23)11(22)10(21)6(4-20)24-14/h1-3,5-6,10-11,20-23H,4H2,(H2,15,17,18)/t6-,10-,11-,14+/m1/s1 |
| InChIKey | XSVCBZKRDQTBHF-GUWQYBKKSA-N |
| XLogP | -1.15 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |