C10H12N6O5 — CID 123145266
(1R,3R,4R,5R)-3-(2,6-diaminopurin-9-yl)-2-oxabicyclo[3.1.0]hexane-3,4,5,6-tetrol (PubChem CID 123145266) has the molecular formula C10H12N6O5 and a molecular weight of 296.24 g/mol. Its IUPAC name is (1R,3R,4R,5R)-3-(2,6-diaminopurin-9-yl)-2-oxabicyclo[3.1.0]hexane-3,4,5,6-tetrol.
| Compound Name | (1R,3R,4R,5R)-3-(2,6-diaminopurin-9-yl)-2-oxabicyclo[3.1.0]hexane-3,4,5,6-tetrol |
|---|---|
| PubChem CID | 123145266 |
| Molecular Formula | C10H12N6O5 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (1R,3R,4R,5R)-3-(2,6-diaminopurin-9-yl)-2-oxabicyclo[3.1.0]hexane-3,4,5,6-tetrol |
| SMILES | Nc1nc(N)c2ncn([C@]3(O)O[C@@H]4C(O)[C@@]4(O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H12N6O5/c11-5-2-6(15-8(12)14-5)16(1-13-2)10(20)7(18)9(19)3(17)4(9)21-10/h1,3-4,7,17-20H,(H4,11,12,14,15)/t3?,4-,7-,9+,10-/m1/s1 |
| InChIKey | ZBAGMHXDNCSTAO-GWXCFPAASA-N |
| XLogP | -3.54 |
| TPSA | 185.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |