C17H20O7 — CID 174566451
(2R)-2-benzyl-1-(furan-2-yl)-3,4,5-trihydroxy-2-methylperoxypentan-1-one (PubChem CID 174566451) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is (2R)-2-benzyl-1-(furan-2-yl)-3,4,5-trihydroxy-2-methylperoxypentan-1-one.
| Compound Name | (2R)-2-benzyl-1-(furan-2-yl)-3,4,5-trihydroxy-2-methylperoxypentan-1-one |
|---|---|
| PubChem CID | 174566451 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (2R)-2-benzyl-1-(furan-2-yl)-3,4,5-trihydroxy-2-methylperoxypentan-1-one |
| SMILES | COO[C@@](Cc1ccccc1)(C(=O)c1ccco1)C(O)C(O)CO |
| InChI | InChI=1S/C17H20O7/c1-22-24-17(15(20)13(19)11-18,10-12-6-3-2-4-7-12)16(21)14-8-5-9-23-14/h2-9,13,15,18-20H,10-11H2,1H3/t13?,15?,17-/m1/s1 |
| InChIKey | XZWAPMZJCJFJCM-PUJMQQBBSA-N |
| XLogP | 0.74 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|