About (1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride
(1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride (PubChem CID 174567054) has the molecular formula C10H19ClN2O4
and a molecular weight of 266.72 g/mol. Its IUPAC name is (1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride.
Molecular Properties
| Compound Name | (1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride |
| PubChem CID | 174567054 |
| Molecular Formula | C10H19ClN2O4 |
| Molecular Weight | 266.72 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride |
| SMILES | CCCC(N)C(O)C(=O)OC1(C(N)=O)CC1.Cl |
| InChI | InChI=1S/C10H18N2O4.ClH/c1-2-3-6(11)7(13)8(14)16-10(4-5-10)9(12)15;/h6-7,13H,2-5,11H2,1H3,(H2,12,15);1H |
| InChIKey | VWGFMDDJNDQGNW-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.72 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride?
The IUPAC name of (1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride (CID 174567054) is (1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride.
What is the SMILES notation for (1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride?
The canonical SMILES for (1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride is CCCC(N)C(O)C(=O)OC1(C(N)=O)CC1.Cl.
What is the InChIKey of (1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride?
The InChIKey is VWGFMDDJNDQGNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O4.ClH/c1-2-3-6(11)7(13)8(14)16-10(4-5-10)9(12)15;/h6-7,13H,2-5,11H2,1H3,(H2,12,15);1H.
What are the key properties of (1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride?
(1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride has a molecular weight of 266.72 g/mol, XLogP of -0.54, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carbamoylcyclopropyl) 3-amino-2-hydroxyhexanoate;hydrochloride is sourced from PubChem (CID 174567054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).