C20H28N2O5 — CID 174567098
1,3-dinitrobenzene;2-propan-2-yloxypropane;1,2-xylene (PubChem CID 174567098) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is 1,3-dinitrobenzene;2-propan-2-yloxypropane;1,2-xylene.
| Compound Name | 1,3-dinitrobenzene;2-propan-2-yloxypropane;1,2-xylene |
|---|---|
| PubChem CID | 174567098 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1,3-dinitrobenzene;2-propan-2-yloxypropane;1,2-xylene |
| SMILES | CC(C)OC(C)C.Cc1ccccc1C.O=[N+]([O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H10.C6H4N2O4.C6H14O/c1-7-5-3-4-6-8(7)2;9-7(10)5-2-1-3-6(4-5)8(11)12;1-5(2)7-6(3)4/h3-6H,1-2H3;1-4H;5-6H,1-4H3 |
| InChIKey | ZKXDERURTAPGCJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|