C14H22N2Ru — CID 174567277
2,3-dipropyl-1H-pyrrole;1H-pyrrole;ruthenium (PubChem CID 174567277) has the molecular formula C14H22N2Ru and a molecular weight of 319.41 g/mol. Its IUPAC name is 2,3-dipropyl-1H-pyrrole;1H-pyrrole;ruthenium.
| Compound Name | 2,3-dipropyl-1H-pyrrole;1H-pyrrole;ruthenium |
|---|---|
| PubChem CID | 174567277 |
| Molecular Formula | C14H22N2Ru |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2,3-dipropyl-1H-pyrrole;1H-pyrrole;ruthenium |
| SMILES | CCCc1cc[nH]c1CCC.[Ru].c1cc[nH]c1 |
| InChI | InChI=1S/C10H17N.C4H5N.Ru/c1-3-5-9-7-8-11-10(9)6-4-2;1-2-4-5-3-1;/h7-8,11H,3-6H2,1-2H3;1-5H; |
| InChIKey | UZMAMYNKBJHSEW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |