C25H23ClN2O2S — CID 174571960
2-(4-chlorophenyl)-6-[4-(1-hydroxy-4-imino-2-methylpentyl)phenyl]thieno[2,3-c]pyridin-7-one (PubChem CID 174571960) has the molecular formula C25H23ClN2O2S and a molecular weight of 450.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-[4-(1-hydroxy-4-imino-2-methylpentyl)phenyl]thieno[2,3-c]pyridin-7-one.
| Compound Name | 2-(4-chlorophenyl)-6-[4-(1-hydroxy-4-imino-2-methylpentyl)phenyl]thieno[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 174571960 |
| Molecular Formula | C25H23ClN2O2S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 2-(4-chlorophenyl)-6-[4-(1-hydroxy-4-imino-2-methylpentyl)phenyl]thieno[2,3-c]pyridin-7-one |
| SMILES | [H]/N=C(\C)CC(C)C(O)c1ccc(-n2ccc3cc(-c4ccc(Cl)cc4)sc3c2=O)cc1 |
| InChI | InChI=1S/C25H23ClN2O2S/c1-15(13-16(2)27)23(29)18-5-9-21(10-6-18)28-12-11-19-14-22(31-24(19)25(28)30)17-3-7-20(26)8-4-17/h3-12,14-15,23,27,29H,13H2,1-2H3/b27-16+ |
| InChIKey | ORENLCBVIJJTOS-JVWAILMASA-N |
| XLogP | 6.47 |
| TPSA | 66.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|